C17H16N6O3S — CID 8953217
N'-[(2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropanoyl]benzohydrazide (PubChem CID 8953217) has the molecular formula C17H16N6O3S and a molecular weight of 384.42 g/mol. Its IUPAC name is N'-[(2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropanoyl]benzohydrazide.
| Compound Name | N'-[(2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8953217 |
| Molecular Formula | C17H16N6O3S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N'-[(2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropanoyl]benzohydrazide |
| SMILES | C[C@H](Sc1nnnn1-c1ccc(O)cc1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N6O3S/c1-11(15(25)18-19-16(26)12-5-3-2-4-6-12)27-17-20-21-22-23(17)13-7-9-14(24)10-8-13/h2-11,24H,1H3,(H,18,25)(H,19,26)/t11-/m0/s1 |
| InChIKey | CXGXQGJHSBOXSF-NSHDSACASA-N |
| XLogP | 1.31 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|