C12H14N6O2S — CID 8873153
N'-[(2R)-2-(1-methyltetrazol-5-yl)sulfanylpropanoyl]benzohydrazide (PubChem CID 8873153) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is N'-[(2R)-2-(1-methyltetrazol-5-yl)sulfanylpropanoyl]benzohydrazide.
| Compound Name | N'-[(2R)-2-(1-methyltetrazol-5-yl)sulfanylpropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8873153 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N'-[(2R)-2-(1-methyltetrazol-5-yl)sulfanylpropanoyl]benzohydrazide |
| SMILES | C[C@@H](Sc1nnnn1C)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14N6O2S/c1-8(21-12-15-16-17-18(12)2)10(19)13-14-11(20)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,13,19)(H,14,20)/t8-/m1/s1 |
| InChIKey | CAYJQSXTNJMRFT-MRVPVSSYSA-N |
| XLogP | 0.15 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|