C12H13FN6O2S — CID 32709626
(2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 32709626) has the molecular formula C12H13FN6O2S and a molecular weight of 324.34 g/mol. Its IUPAC name is (2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 32709626 |
| Molecular Formula | C12H13FN6O2S |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1nnnn1C)C(=O)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H13FN6O2S/c1-7(22-12-16-17-18-19(12)2)10(20)15-11(21)14-9-6-4-3-5-8(9)13/h3-7H,1-2H3,(H2,14,15,20,21)/t7-/m1/s1 |
| InChIKey | OLEMZJCAOZPDGB-SSDOTTSWSA-N |
| XLogP | 1.18 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |