C13H12FN3O2S2 — CID 129367933
(2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide (PubChem CID 129367933) has the molecular formula C13H12FN3O2S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is (2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide.
| Compound Name | (2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 129367933 |
| Molecular Formula | C13H12FN3O2S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (2R)-N-[(2-fluorophenyl)carbamoyl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
| SMILES | C[C@@H](Sc1nccs1)C(=O)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H12FN3O2S2/c1-8(21-13-15-6-7-20-13)11(18)17-12(19)16-10-5-3-2-4-9(10)14/h2-8H,1H3,(H2,16,17,18,19)/t8-/m1/s1 |
| InChIKey | UYANTNLKPIJKEW-MRVPVSSYSA-N |
| XLogP | 3.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|