C12H11N3O3S2 — CID 94196767
(2S)-N-(2-nitrophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide (PubChem CID 94196767) has the molecular formula C12H11N3O3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2S)-N-(2-nitrophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-nitrophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 94196767 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | (2S)-N-(2-nitrophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1nccs1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O3S2/c1-8(20-12-13-6-7-19-12)11(16)14-9-4-2-3-5-10(9)15(17)18/h2-8H,1H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | YWOUGYPUVQNYMV-QMMMGPOBSA-N |
| XLogP | 3.17 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|