C15H12Cl2N2O3S — CID 7847873
(2R)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-nitrophenyl)propanamide (PubChem CID 7847873) has the molecular formula C15H12Cl2N2O3S and a molecular weight of 371.25 g/mol. Its IUPAC name is (2R)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-nitrophenyl)propanamide.
| Compound Name | (2R)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7847873 |
| Molecular Formula | C15H12Cl2N2O3S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | (2R)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-nitrophenyl)propanamide |
| SMILES | C[C@@H](Sc1c(Cl)cccc1Cl)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12Cl2N2O3S/c1-9(23-14-10(16)5-4-6-11(14)17)15(20)18-12-7-2-3-8-13(12)19(21)22/h2-9H,1H3,(H,18,20)/t9-/m1/s1 |
| InChIKey | GYKLWIQLGYRPRA-SECBINFHSA-N |
| XLogP | 5.02 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|