C21H17Cl2NOS — CID 7466949
(2S)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-phenylphenyl)propanamide (PubChem CID 7466949) has the molecular formula C21H17Cl2NOS and a molecular weight of 402.35 g/mol. Its IUPAC name is (2S)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-phenylphenyl)propanamide.
| Compound Name | (2S)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 7466949 |
| Molecular Formula | C21H17Cl2NOS |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (2S)-2-(2,6-dichlorophenyl)sulfanyl-N-(2-phenylphenyl)propanamide |
| SMILES | C[C@H](Sc1c(Cl)cccc1Cl)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H17Cl2NOS/c1-14(26-20-17(22)11-7-12-18(20)23)21(25)24-19-13-6-5-10-16(19)15-8-3-2-4-9-15/h2-14H,1H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | DFTBIAYTWUUUNE-AWEZNQCLSA-N |
| XLogP | 6.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |