C19H23NOS — CID 112781235
2-butylsulfanyl-N-(2-phenylphenyl)propanamide (PubChem CID 112781235) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(2-phenylphenyl)propanamide.
| Compound Name | 2-butylsulfanyl-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 112781235 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-butylsulfanyl-N-(2-phenylphenyl)propanamide |
| SMILES | CCCCSC(C)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H23NOS/c1-3-4-14-22-15(2)19(21)20-18-13-9-8-12-17(18)16-10-6-5-7-11-16/h5-13,15H,3-4,14H2,1-2H3,(H,20,21) |
| InChIKey | VIEPHCISNUQHHC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|