C19H23NO4S — CID 119219227
2-[4-(2-butylsulfanylpropanoylamino)naphthalen-1-yl]oxyacetic acid (PubChem CID 119219227) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-[4-(2-butylsulfanylpropanoylamino)naphthalen-1-yl]oxyacetic acid.
| Compound Name | 2-[4-(2-butylsulfanylpropanoylamino)naphthalen-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 119219227 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[4-(2-butylsulfanylpropanoylamino)naphthalen-1-yl]oxyacetic acid |
| SMILES | CCCCSC(C)C(=O)Nc1ccc(OCC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C19H23NO4S/c1-3-4-11-25-13(2)19(23)20-16-9-10-17(24-12-18(21)22)15-8-6-5-7-14(15)16/h5-10,13H,3-4,11-12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | BOIGWJVZOMCPOG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|