C18H25N3OS — CID 134037906
2-butylsulfanyl-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanamide (PubChem CID 134037906) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanamide.
| Compound Name | 2-butylsulfanyl-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 134037906 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-butylsulfanyl-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanamide |
| SMILES | CCCCSC(C)C(=O)Nc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C18H25N3OS/c1-5-6-12-23-15(4)18(22)19-17-13(2)20-21(14(17)3)16-10-8-7-9-11-16/h7-11,15H,5-6,12H2,1-4H3,(H,19,22) |
| InChIKey | HLGJYIINDBTOTD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|