C16H23NO5S — CID 119214256
3-(2-butylsulfanylpropanoylamino)-4,5-dimethoxybenzoic acid (PubChem CID 119214256) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-(2-butylsulfanylpropanoylamino)-4,5-dimethoxybenzoic acid.
| Compound Name | 3-(2-butylsulfanylpropanoylamino)-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 119214256 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-(2-butylsulfanylpropanoylamino)-4,5-dimethoxybenzoic acid |
| SMILES | CCCCSC(C)C(=O)Nc1cc(C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C16H23NO5S/c1-5-6-7-23-10(2)15(18)17-12-8-11(16(19)20)9-13(21-3)14(12)22-4/h8-10H,5-7H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | SNJUFRZXFZAIPC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|