C16H12ClF3N2O3S — CID 7397774
(2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-nitrophenyl)propanamide (PubChem CID 7397774) has the molecular formula C16H12ClF3N2O3S and a molecular weight of 404.80 g/mol. Its IUPAC name is (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7397774 |
| Molecular Formula | C16H12ClF3N2O3S |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-nitrophenyl)propanamide |
| SMILES | C[C@@H](Sc1ccc(Cl)c(C(F)(F)F)c1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClF3N2O3S/c1-9(15(23)21-13-4-2-3-5-14(13)22(24)25)26-10-6-7-12(17)11(8-10)16(18,19)20/h2-9H,1H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | NCCFVIAJLRKJDL-SECBINFHSA-N |
| XLogP | 5.39 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|