C16H13ClF3NOS — CID 7820937
(2R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylsulfanylpropanamide (PubChem CID 7820937) has the molecular formula C16H13ClF3NOS and a molecular weight of 359.80 g/mol. Its IUPAC name is (2R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylsulfanylpropanamide.
| Compound Name | (2R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 7820937 |
| Molecular Formula | C16H13ClF3NOS |
| Molecular Weight | 359.80 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylsulfanylpropanamide |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H13ClF3NOS/c1-10(23-12-5-3-2-4-6-12)15(22)21-14-9-11(16(18,19)20)7-8-13(14)17/h2-10H,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | CWMKIJZLYRSZMS-SNVBAGLBSA-N |
| XLogP | 5.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |