C25H20ClF3N2O2S — CID 23100533
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide (PubChem CID 23100533) has the molecular formula C25H20ClF3N2O2S and a molecular weight of 504.96 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 23100533 |
| Molecular Formula | C25H20ClF3N2O2S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1ccc(NC(=O)/C=C/c2ccccc2)cc1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C25H20ClF3N2O2S/c1-16(24(33)31-22-15-18(25(27,28)29)8-13-21(22)26)34-20-11-9-19(10-12-20)30-23(32)14-7-17-5-3-2-4-6-17/h2-16H,1H3,(H,30,32)(H,31,33)/b14-7+ |
| InChIKey | ZNBPBAIUFMBXPY-VGOFMYFVSA-N |
| XLogP | 7.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|