C23H20ClN3O2S — CID 22780809
N-(5-chloro-2-pyridinyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide (PubChem CID 22780809) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 22780809 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1ccc(NC(=O)/C=C/c2ccccc2)cc1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C23H20ClN3O2S/c1-16(23(29)27-21-13-8-18(24)15-25-21)30-20-11-9-19(10-12-20)26-22(28)14-7-17-5-3-2-4-6-17/h2-16H,1H3,(H,26,28)(H,25,27,29)/b14-7+ |
| InChIKey | MFITWDKQIITJOS-VGOFMYFVSA-N |
| XLogP | 5.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|