C22H21N3O2S — CID 55951430
2-(4-acetamidophenyl)sulfanyl-N-(5-phenyl-2-pyridinyl)propanamide (PubChem CID 55951430) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N-(5-phenyl-2-pyridinyl)propanamide.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N-(5-phenyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 55951430 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N-(5-phenyl-2-pyridinyl)propanamide |
| SMILES | CC(=O)Nc1ccc(SC(C)C(=O)Nc2ccc(-c3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-15(28-20-11-9-19(10-12-20)24-16(2)26)22(27)25-21-13-8-18(14-23-21)17-6-4-3-5-7-17/h3-15H,1-2H3,(H,24,26)(H,23,25,27) |
| InChIKey | YEHXDWOJRYWLTH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |