C17H17NO2S — CID 2501504
(2R)-N-(4-acetylphenyl)-2-phenylsulfanylpropanamide (PubChem CID 2501504) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is (2R)-N-(4-acetylphenyl)-2-phenylsulfanylpropanamide.
| Compound Name | (2R)-N-(4-acetylphenyl)-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2501504 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2R)-N-(4-acetylphenyl)-2-phenylsulfanylpropanamide |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](C)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NO2S/c1-12(19)14-8-10-15(11-9-14)18-17(20)13(2)21-16-6-4-3-5-7-16/h3-11,13H,1-2H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | ARZWGCAYBSKQKH-CYBMUJFWSA-N |
| XLogP | 4.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |