C17H15Cl2NO2S — CID 7847771
(2R)-N-(4-acetylphenyl)-2-(2,6-dichlorophenyl)sulfanylpropanamide (PubChem CID 7847771) has the molecular formula C17H15Cl2NO2S and a molecular weight of 368.29 g/mol. Its IUPAC name is (2R)-N-(4-acetylphenyl)-2-(2,6-dichlorophenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-(4-acetylphenyl)-2-(2,6-dichlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7847771 |
| Molecular Formula | C17H15Cl2NO2S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | (2R)-N-(4-acetylphenyl)-2-(2,6-dichlorophenyl)sulfanylpropanamide |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](C)Sc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO2S/c1-10(21)12-6-8-13(9-7-12)20-17(22)11(2)23-16-14(18)4-3-5-15(16)19/h3-9,11H,1-2H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | FQYCMZDIBACBFJ-LLVKDONJSA-N |
| XLogP | 5.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |