C24H21ClFN3O2S2 — CID 19317124
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-chloro-4-fluorophenyl)propanamide (PubChem CID 19317124) has the molecular formula C24H21ClFN3O2S2 and a molecular weight of 502.04 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-chloro-4-fluorophenyl)propanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-chloro-4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 19317124 |
| Molecular Formula | C24H21ClFN3O2S2 |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-chloro-4-fluorophenyl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3ccc(F)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C24H21ClFN3O2S2/c1-14(30)16-6-8-17(9-7-16)28-24(32)29-18-4-3-5-20(12-18)33-15(2)23(31)27-19-10-11-22(26)21(25)13-19/h3-13,15H,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | DYIACCQJRQSJAU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|