C24H21Cl2N3O2S2 — CID 19317129
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)propanamide (PubChem CID 19317129) has the molecular formula C24H21Cl2N3O2S2 and a molecular weight of 518.49 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)propanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 19317129 |
| Molecular Formula | C24H21Cl2N3O2S2 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O2S2/c1-14(30)16-6-9-18(10-7-16)27-24(32)28-19-4-3-5-20(13-19)33-15(2)23(31)29-22-11-8-17(25)12-21(22)26/h3-13,15H,1-2H3,(H,29,31)(H2,27,28,32) |
| InChIKey | PENKVPXBXVWFJF-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|