C25H23Cl2N3O2S2 — CID 19317273
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)butanamide (PubChem CID 19317273) has the molecular formula C25H23Cl2N3O2S2 and a molecular weight of 532.52 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)butanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 19317273 |
| Molecular Formula | C25H23Cl2N3O2S2 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dichlorophenyl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C(C)=O)cc2)c1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O2S2/c1-3-23(24(32)30-22-12-9-17(26)13-21(22)27)34-20-6-4-5-19(14-20)29-25(33)28-18-10-7-16(8-11-18)15(2)31/h4-14,23H,3H2,1-2H3,(H,30,32)(H2,28,29,33) |
| InChIKey | MBQPKSSYRMOFLP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|