C22H23N5O2S3 — CID 19318246
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 19318246) has the molecular formula C22H23N5O2S3 and a molecular weight of 485.66 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 19318246 |
| Molecular Formula | C22H23N5O2S3 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C(C)=O)cc2)c1)C(=O)Nc1nnc(C)s1 |
| InChI | InChI=1S/C22H23N5O2S3/c1-4-19(20(29)25-22-27-26-14(3)31-22)32-18-7-5-6-17(12-18)24-21(30)23-16-10-8-15(9-11-16)13(2)28/h5-12,19H,4H2,1-3H3,(H2,23,24,30)(H,25,27,29) |
| InChIKey | CBBBUDSYWFNIBB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|