C27H28ClN3O4S2 — CID 19317292
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-chloro-2,4-dimethoxyphenyl)butanamide (PubChem CID 19317292) has the molecular formula C27H28ClN3O4S2 and a molecular weight of 558.13 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-chloro-2,4-dimethoxyphenyl)butanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-chloro-2,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 19317292 |
| Molecular Formula | C27H28ClN3O4S2 |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-chloro-2,4-dimethoxyphenyl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C(C)=O)cc2)c1)C(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C27H28ClN3O4S2/c1-5-25(26(33)31-22-14-21(28)23(34-3)15-24(22)35-4)37-20-8-6-7-19(13-20)30-27(36)29-18-11-9-17(10-12-18)16(2)32/h6-15,25H,5H2,1-4H3,(H,31,33)(H2,29,30,36) |
| InChIKey | ORPUMIHGCHCBCF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|