C26H27N3O3S2 — CID 19317300
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-methoxyphenyl)butanamide (PubChem CID 19317300) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-methoxyphenyl)butanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 19317300 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-methoxyphenyl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C(C)=O)cc2)c1)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C26H27N3O3S2/c1-4-24(25(31)27-20-7-5-9-22(15-20)32-3)34-23-10-6-8-21(16-23)29-26(33)28-19-13-11-18(12-14-19)17(2)30/h5-16,24H,4H2,1-3H3,(H,27,31)(H2,28,29,33) |
| InChIKey | LCWWDTVESYPBFT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|