C22H22N2O5S — CID 18896870
(E)-4-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18896870) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is (E)-4-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18896870 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (E)-4-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C=C/C(=O)O)c1)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H22N2O5S/c1-3-19(22(29)24-16-9-7-15(8-10-16)14(2)25)30-18-6-4-5-17(13-18)23-20(26)11-12-21(27)28/h4-13,19H,3H2,1-2H3,(H,23,26)(H,24,29)(H,27,28)/b12-11+ |
| InChIKey | FDWXZKNDRCYQSC-VAWYXSNFSA-N |
| XLogP | 3.98 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|