C19H19N3O4S — CID 18898809
(E)-4-oxo-4-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]but-2-enoic acid (PubChem CID 18898809) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is (E)-4-oxo-4-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 18898809 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (E)-4-oxo-4-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]but-2-enoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C=C/C(=O)O)c1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C19H19N3O4S/c1-2-15(19(26)22-16-8-3-4-11-20-16)27-14-7-5-6-13(12-14)21-17(23)9-10-18(24)25/h3-12,15H,2H2,1H3,(H,21,23)(H,24,25)(H,20,22,26)/b10-9+ |
| InChIKey | BWBDUISWAXLZQI-MDZDMXLPSA-N |
| XLogP | 3.17 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|