C24H23N3O2S — CID 18912525
2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide (PubChem CID 18912525) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide.
| Compound Name | 2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 18912525 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C=C/c2ccccc2)c1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C24H23N3O2S/c1-2-21(24(29)27-22-13-6-7-16-25-22)30-20-12-8-11-19(17-20)26-23(28)15-14-18-9-4-3-5-10-18/h3-17,21H,2H2,1H3,(H,26,28)(H,25,27,29)/b15-14+ |
| InChIKey | IHNRRXDPDBHRCA-CCEZHUSRSA-N |
| XLogP | 5.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|