C23H23N3O2S — CID 19298709
2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide (PubChem CID 19298709) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide.
| Compound Name | 2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 19298709 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-pyridin-2-ylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=O)Cc2ccccc2)c1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C23H23N3O2S/c1-2-20(23(28)26-21-13-6-7-14-24-21)29-19-12-8-11-18(16-19)25-22(27)15-17-9-4-3-5-10-17/h3-14,16,20H,2,15H2,1H3,(H,25,27)(H,24,26,28) |
| InChIKey | MPDIGMATRWQYTA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |