C25H23ClN2O4S — CID 18906025
4-chloro-3-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid (PubChem CID 18906025) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is 4-chloro-3-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid.
| Compound Name | 4-chloro-3-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18906025 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 4-chloro-3-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)Cc2ccccc2)c1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C25H23ClN2O4S/c1-2-22(24(30)28-21-14-17(25(31)32)11-12-20(21)26)33-19-10-6-9-18(15-19)27-23(29)13-16-7-4-3-5-8-16/h3-12,14-15,22H,2,13H2,1H3,(H,27,29)(H,28,30)(H,31,32) |
| InChIKey | GUBIYNUFTMYVGC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |