C25H23F3N2O2S — CID 18905971
2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]butanamide (PubChem CID 18905971) has the molecular formula C25H23F3N2O2S and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 18905971 |
| Molecular Formula | C25H23F3N2O2S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[3-[(2-phenylacetyl)amino]phenyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCC(Sc1cccc(NC(=O)Cc2ccccc2)c1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H23F3N2O2S/c1-2-22(24(32)30-21-14-7-6-13-20(21)25(26,27)28)33-19-12-8-11-18(16-19)29-23(31)15-17-9-4-3-5-10-17/h3-14,16,22H,2,15H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | LBSPCTXUSLZWNL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |