C30H28N2O3S — CID 18906022
N-(4-phenoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanamide (PubChem CID 18906022) has the molecular formula C30H28N2O3S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanamide.
| Compound Name | N-(4-phenoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 18906022 |
| Molecular Formula | C30H28N2O3S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-(4-phenoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=O)Cc2ccccc2)c1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O3S/c1-2-28(30(34)32-23-16-18-26(19-17-23)35-25-13-7-4-8-14-25)36-27-15-9-12-24(21-27)31-29(33)20-22-10-5-3-6-11-22/h3-19,21,28H,2,20H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | DDYJFFTYAHVBEF-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |