C27H28N2O5S — CID 18905713
ethyl 4-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoate (PubChem CID 18905713) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is ethyl 4-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 18905713 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl 4-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)COc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H28N2O5S/c1-3-24(26(31)29-20-15-13-19(14-16-20)27(32)33-4-2)35-23-12-8-9-21(17-23)28-25(30)18-34-22-10-6-5-7-11-22/h5-17,24H,3-4,18H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | OHLIEVQPMRZYIB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |