C25H24N2O5S — CID 18905739
3-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid (PubChem CID 18905739) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid.
| Compound Name | 3-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18905739 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)COc2ccccc2)c1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H24N2O5S/c1-2-22(24(29)27-18-9-6-8-17(14-18)25(30)31)33-21-13-7-10-19(15-21)26-23(28)16-32-20-11-4-3-5-12-20/h3-15,22H,2,16H2,1H3,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | OKWCRRCCRNPXDQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |