C30H34N2O5S2 — CID 18910891
methyl 2-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18910891) has the molecular formula C30H34N2O5S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is methyl 2-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910891 |
| Molecular Formula | C30H34N2O5S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | methyl 2-[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)COc2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCCCCC2 |
| InChI | InChI=1S/C30H34N2O5S2/c1-3-24(28(34)32-29-27(30(35)36-2)23-16-9-4-5-10-17-25(23)39-29)38-22-15-11-12-20(18-22)31-26(33)19-37-21-13-7-6-8-14-21/h6-8,11-15,18,24H,3-5,9-10,16-17,19H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | IRTQEKXJVNTXDS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |