C27H36N2O4S2 — CID 18909044
ethyl 2-[2-[3-(butanoylamino)phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18909044) has the molecular formula C27H36N2O4S2 and a molecular weight of 516.73 g/mol. Its IUPAC name is ethyl 2-[2-[3-(butanoylamino)phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-(butanoylamino)phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909044 |
| Molecular Formula | C27H36N2O4S2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | ethyl 2-[2-[3-(butanoylamino)phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCCC(=O)Nc1cccc(SC(CC)C(=O)Nc2sc3c(c2C(=O)OCC)CCCCCC3)c1 |
| InChI | InChI=1S/C27H36N2O4S2/c1-4-12-23(30)28-18-13-11-14-19(17-18)34-21(5-2)25(31)29-26-24(27(32)33-6-3)20-15-9-7-8-10-16-22(20)35-26/h11,13-14,17,21H,4-10,12,15-16H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | YNLLNVOBXIHJOL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |