C24H30N2O4S2 — CID 18908714
ethyl 2-[2-(3-acetamidophenyl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18908714) has the molecular formula C24H30N2O4S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is ethyl 2-[2-(3-acetamidophenyl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(3-acetamidophenyl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18908714 |
| Molecular Formula | C24H30N2O4S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | ethyl 2-[2-(3-acetamidophenyl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(C)=O)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C24H30N2O4S2/c1-4-30-24(29)21-19-12-7-5-6-8-13-20(19)32-23(21)26-22(28)15(2)31-18-11-9-10-17(14-18)25-16(3)27/h9-11,14-15H,4-8,12-13H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | IJEXTBYQDIMUKB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |