C27H30N2O5S2 — CID 18910298
ethyl 2-[2-[3-(furan-2-carbonylamino)phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18910298) has the molecular formula C27H30N2O5S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is ethyl 2-[2-[3-(furan-2-carbonylamino)phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-(furan-2-carbonylamino)phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910298 |
| Molecular Formula | C27H30N2O5S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | ethyl 2-[2-[3-(furan-2-carbonylamino)phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)c3ccco3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C27H30N2O5S2/c1-3-33-27(32)23-20-12-6-4-5-7-14-22(20)36-26(23)29-24(30)17(2)35-19-11-8-10-18(16-19)28-25(31)21-13-9-15-34-21/h8-11,13,15-17H,3-7,12,14H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | ZXHVCCWEACNXFG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |