C28H29ClN2O4S2 — CID 18910429
methyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18910429) has the molecular formula C28H29ClN2O4S2 and a molecular weight of 557.14 g/mol. Its IUPAC name is methyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910429 |
| Molecular Formula | C28H29ClN2O4S2 |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | methyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)c3cccc(Cl)c3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C28H29ClN2O4S2/c1-17(36-21-12-8-11-20(16-21)30-26(33)18-9-7-10-19(29)15-18)25(32)31-27-24(28(34)35-2)22-13-5-3-4-6-14-23(22)37-27/h7-12,15-17H,3-6,13-14H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | GYCITIPDBUSUBH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |