C30H32N2O4S2 — CID 18909109
methyl 2-[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18909109) has the molecular formula C30H32N2O4S2 and a molecular weight of 548.73 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909109 |
| Molecular Formula | C30H32N2O4S2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C=C/c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C30H32N2O4S2/c1-20(28(34)32-29-27(30(35)36-2)24-15-8-3-4-9-16-25(24)38-29)37-23-14-10-13-22(19-23)31-26(33)18-17-21-11-6-5-7-12-21/h5-7,10-14,17-20H,3-4,8-9,15-16H2,1-2H3,(H,31,33)(H,32,34)/b18-17+ |
| InChIKey | MOXUBSXOZRLLGM-ISLYRVAYSA-N |
| XLogP | 6.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|