C35H34N2O4S2 — CID 18909208
methyl 2-[[2-phenyl-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18909208) has the molecular formula C35H34N2O4S2 and a molecular weight of 610.80 g/mol. Its IUPAC name is methyl 2-[[2-phenyl-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-phenyl-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909208 |
| Molecular Formula | C35H34N2O4S2 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | methyl 2-[[2-phenyl-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)/C=C/c3ccccc3)c2)c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C35H34N2O4S2/c1-41-35(40)31-28-19-10-2-3-11-20-29(28)43-34(31)37-33(39)32(25-15-8-5-9-16-25)42-27-18-12-17-26(23-27)36-30(38)22-21-24-13-6-4-7-14-24/h4-9,12-18,21-23,32H,2-3,10-11,19-20H2,1H3,(H,36,38)(H,37,39)/b22-21+ |
| InChIKey | RFZYMETVJRLGTR-QURGRASLSA-N |
| XLogP | 8.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|