C35H36N2O4S2 — CID 18911057
ethyl 2-[[2-phenyl-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18911057) has the molecular formula C35H36N2O4S2 and a molecular weight of 612.82 g/mol. Its IUPAC name is ethyl 2-[[2-phenyl-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-phenyl-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18911057 |
| Molecular Formula | C35H36N2O4S2 |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | ethyl 2-[[2-phenyl-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)Cc3ccccc3)c2)c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C35H36N2O4S2/c1-2-41-35(40)31-28-20-11-3-4-12-21-29(28)43-34(31)37-33(39)32(25-16-9-6-10-17-25)42-27-19-13-18-26(23-27)36-30(38)22-24-14-7-5-8-15-24/h5-10,13-19,23,32H,2-4,11-12,20-22H2,1H3,(H,36,38)(H,37,39) |
| InChIKey | RSLKSGAHKVVQMK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |