C34H32N2O6S2 — CID 18897664
2-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897664) has the molecular formula C34H32N2O6S2 and a molecular weight of 628.77 g/mol. Its IUPAC name is 2-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897664 |
| Molecular Formula | C34H32N2O6S2 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | 2-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)c3ccccc3C(=O)O)c2)c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C34H32N2O6S2/c1-42-34(41)28-26-18-7-2-3-8-19-27(26)44-32(28)36-31(38)29(21-12-5-4-6-13-21)43-23-15-11-14-22(20-23)35-30(37)24-16-9-10-17-25(24)33(39)40/h4-6,9-17,20,29H,2-3,7-8,18-19H2,1H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | YPJDZRABOMPNHA-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |