C30H33N3O6S2 — CID 18910628
ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18910628) has the molecular formula C30H33N3O6S2 and a molecular weight of 595.74 g/mol. Its IUPAC name is ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910628 |
| Molecular Formula | C30H33N3O6S2 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)Sc2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C30H33N3O6S2/c1-3-24(28(35)32-29-26(30(36)39-4-2)23-15-7-5-6-8-16-25(23)41-29)40-22-14-10-12-20(18-22)31-27(34)19-11-9-13-21(17-19)33(37)38/h9-14,17-18,24H,3-8,15-16H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | USRBKMSFOOEHAC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|