C21H23ClN2O4S — CID 18903001
4-chloro-3-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 18903001) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is 4-chloro-3-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-chloro-3-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18903001 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-chloro-3-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CCCCC(=O)Nc1cccc(SC(C)C(=O)Nc2cc(C(=O)O)ccc2Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-3-4-8-19(25)23-15-6-5-7-16(12-15)29-13(2)20(26)24-18-11-14(21(27)28)9-10-17(18)22/h5-7,9-13H,3-4,8H2,1-2H3,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | PYNAMOZORHGGPO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |