C25H32N2O4S — CID 18903015
butyl 4-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 18903015) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is butyl 4-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 18903015 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | butyl 4-[2-[3-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2cccc(NC(=O)CCCC)c2)cc1 |
| InChI | InChI=1S/C25H32N2O4S/c1-4-6-11-23(28)26-21-9-8-10-22(17-21)32-18(3)24(29)27-20-14-12-19(13-15-20)25(30)31-16-7-5-2/h8-10,12-15,17-18H,4-7,11,16H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | CLQRKLOSEPKWSA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|