C27H31N3O2S2 — CID 19316592
N-(4-butoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide (PubChem CID 19316592) has the molecular formula C27H31N3O2S2 and a molecular weight of 493.70 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(4-butoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316592 |
| Molecular Formula | C27H31N3O2S2 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-(4-butoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
| SMILES | CCCCOc1ccc(NC(=O)C(C)Sc2cccc(NC(=S)Nc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H31N3O2S2/c1-4-5-17-32-24-15-13-21(14-16-24)28-26(31)20(3)34-25-8-6-7-23(18-25)30-27(33)29-22-11-9-19(2)10-12-22/h6-16,18,20H,4-5,17H2,1-3H3,(H,28,31)(H2,29,30,33) |
| InChIKey | RFMQDNORIDKKKZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|