C21H24Cl2N2O2S — CID 18903104
N-[3-[1-(2,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide (PubChem CID 18903104) has the molecular formula C21H24Cl2N2O2S and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[3-[1-(2,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide.
| Compound Name | N-[3-[1-(2,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 18903104 |
| Molecular Formula | C21H24Cl2N2O2S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-[3-[1-(2,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(SC(CC)C(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N2O2S/c1-3-5-9-20(26)24-15-7-6-8-16(13-15)28-19(4-2)21(27)25-18-11-10-14(22)12-17(18)23/h6-8,10-13,19H,3-5,9H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | ONAHZDPFZDJSMS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |