C22H28N2O3S — CID 18903130
N-[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide (PubChem CID 18903130) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide.
| Compound Name | N-[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 18903130 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(SC(CC)C(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-4-6-14-21(25)23-16-10-9-11-17(15-16)28-20(5-2)22(26)24-18-12-7-8-13-19(18)27-3/h7-13,15,20H,4-6,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | UOJHAOQADRJZMO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |