C22H26N2O4S — CID 22776337
4-methyl-3-[2-[4-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 22776337) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-methyl-3-[2-[4-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-methyl-3-[2-[4-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 22776337 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-methyl-3-[2-[4-(pentanoylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CCCCC(=O)Nc1ccc(SC(C)C(=O)Nc2cc(C(=O)O)ccc2C)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-4-5-6-20(25)23-17-9-11-18(12-10-17)29-15(3)21(26)24-19-13-16(22(27)28)8-7-14(19)2/h7-13,15H,4-6H2,1-3H3,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | UPETWLRQCFFYBS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |