C24H26N2O2S — CID 19631573
N-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]pentanamide (PubChem CID 19631573) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]pentanamide.
| Compound Name | N-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 19631573 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SC(C)C(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-3-4-12-23(27)25-19-13-15-20(16-14-19)29-17(2)24(28)26-22-11-7-9-18-8-5-6-10-21(18)22/h5-11,13-17H,3-4,12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WDRUHVYLMBBEMF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |